![2-Amino-5,6,7,8-tetrahydro-4H-cyclohepta-[b]thiophene-3-carboxamide (CAS: 40106-12-5) - Chemical Structure and Molecular Formula](/static/img/prod_pic/FT-0678502.png "2-Amino-5,6,7,8-tetrahydro-4H-cyclohepta-[b]thiophene-3-carboxamide chemical structure")
2-Amino-5,6,7,8-tetrahydro-4H-cyclohepta-[b]thiophene-3-carboxamide
Catalog No: FT-0678502
CAS No: 40106-12-5
- Chemical Name: 2-Amino-5,6,7,8-tetrahydro-4H-cyclohepta-[b]thiophene-3-carboxamide
- Molecular Formula: C10H14N2OS
- Molecular Weight: 210.30
- InChI Key: LULYZYNTDPUEKK-UHFFFAOYSA-N
- InChI: InChI=1S/C10H14N2OS/c11-9(13)8-6-4-2-1-3-5-7(6)14-10(8)12/h1-5,12H2,(H2,11,13)
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | Warning |
|---|---|
| FW: | 210.29600 |
| Density: | 1.278g/cm3 |
| CAS: | 40106-12-5 |
| Bolling_Point: | 347.5ºC at 760 mmHg |
| Product_Name: | 2-amino-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene-3-carboxamide |
| Melting_Point: | N/A |
| Flash_Point: | 163.9ºC |
| MF: | C10H14N2OS |
| Density: | 1.278g/cm3 |
|---|---|
| LogP: | 2.97960 |
| Flash_Point: | 163.9ºC |
| Refractive_Index: | 1.639 |
| FW: | 210.29600 |
| PSA: | 97.35000 |
| MF: | C10H14N2OS |
| Bolling_Point: | 347.5ºC at 760 mmHg |
| Exact_Mass: | 210.08300 |
| Symbol: | GHS07 |
|---|---|
| Safety_Statements: | H302 |
| HS_Code: | 2934999090 |
| RIDADR: | NONH for all modes of transport |
Related Products
Acetamide, N-[(6R)-6-amino-4,5,6,7-tetrahydro-2-benzothiazolyl]-
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-